![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| assembler boot camp 2 - instructions and addressing.pdf | 2011-05-31 06:28 | 328K | |
| assembler boot camp 3 - assembling and execution, branching.pdf | 2011-05-31 06:28 | 320K | |
| assembler boot camp 5 - decimal and logical instructions.pdf | 2011-05-31 06:27 | 289K | |
| assembler boot camp 4 - arithmetic - program structure.pdf | 2011-05-31 06:28 | 255K | |
| assembler boot camp 1 - number and basic arithmetics.pdf | 2011-05-31 06:28 | 246K | |
| index.html?C=S;O=D | 2021-10-25 21:20 | 2.3K | |
| index.html?C=S;O=A | 2021-10-25 21:20 | 2.3K | |
| index.html?C=N;O=D | 2021-10-25 21:20 | 2.3K | |
| index.html?C=N;O=A | 2021-10-25 21:20 | 2.3K | |
| index.html?C=M;O=D | 2021-10-25 21:20 | 2.3K | |
| index.html?C=M;O=A | 2021-10-25 21:20 | 2.3K | |
| index.html?C=D;O=D | 2021-10-25 21:20 | 2.3K | |
| index.html?C=D;O=A | 2021-10-25 21:20 | 2.3K | |